C27H33F3N2O4 — CID 153291094
2-[5-[1-[3,3,3-trifluoro-2-hydroxy-2-(3-methoxyphenyl)propanoyl]piperidin-4-yl]pentyl]benzamide (PubChem CID 153291094) has the molecular formula C27H33F3N2O4 and a molecular weight of 506.57 g/mol. Its IUPAC name is 2-[5-[1-[3,3,3-trifluoro-2-hydroxy-2-(3-methoxyphenyl)propanoyl]piperidin-4-yl]pentyl]benzamide.
| Compound Name | 2-[5-[1-[3,3,3-trifluoro-2-hydroxy-2-(3-methoxyphenyl)propanoyl]piperidin-4-yl]pentyl]benzamide |
|---|---|
| PubChem CID | 153291094 |
| Molecular Formula | C27H33F3N2O4 |
| Molecular Weight | 506.57 g/mol |
| Exact Mass | 506.24 |
| IUPAC Name | 2-[5-[1-[3,3,3-trifluoro-2-hydroxy-2-(3-methoxyphenyl)propanoyl]piperidin-4-yl]pentyl]benzamide |
| SMILES | COc1cccc(C(O)(C(=O)N2CCC(CCCCCc3ccccc3C(N)=O)CC2)C(F)(F)F)c1 |
| InChI | InChI=1S/C27H33F3N2O4/c1-36-22-12-7-11-21(18-22)26(35,27(28,29)30)25(34)32-16-14-19(15-17-32)8-3-2-4-9-20-10-5-6-13-23(20)24(31)33/h5-7,10-13,18-19,35H,2-4,8-9,14-17H2,1H3,(H2,31,33) |
| InChIKey | XELFGWDOOJPCEE-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.57 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|