C34H41ClF2N2O2 — CID 134434137
3-[4-[4-[3-chloro-4-[1-(ethylamino)propa-1,2-dienyl]phenoxy]butyl]piperidin-1-yl]-5,5-difluoro-4-phenylocta-1,2,7-trien-4-ol (PubChem CID 134434137) has the molecular formula C34H41ClF2N2O2 and a molecular weight of 583.16 g/mol. Its IUPAC name is 3-[4-[4-[3-chloro-4-[1-(ethylamino)propa-1,2-dienyl]phenoxy]butyl]piperidin-1-yl]-5,5-difluoro-4-phenylocta-1,2,7-trien-4-ol.
| Compound Name | 3-[4-[4-[3-chloro-4-[1-(ethylamino)propa-1,2-dienyl]phenoxy]butyl]piperidin-1-yl]-5,5-difluoro-4-phenylocta-1,2,7-trien-4-ol |
|---|---|
| PubChem CID | 134434137 |
| Molecular Formula | C34H41ClF2N2O2 |
| Molecular Weight | 583.16 g/mol |
| Exact Mass | 582.28 |
| IUPAC Name | 3-[4-[4-[3-chloro-4-[1-(ethylamino)propa-1,2-dienyl]phenoxy]butyl]piperidin-1-yl]-5,5-difluoro-4-phenylocta-1,2,7-trien-4-ol |
| SMILES | C=C=C(NCC)c1ccc(OCCCCC2CCN(C(=C=C)C(O)(c3ccccc3)C(F)(F)CC=C)CC2)cc1Cl |
| InChI | InChI=1S/C34H41ClF2N2O2/c1-5-21-33(36,37)34(40,27-15-10-9-11-16-27)32(7-3)39-22-19-26(20-23-39)14-12-13-24-41-28-17-18-29(30(35)25-28)31(6-2)38-8-4/h5,9-11,15-18,25-26,38,40H,1-3,8,12-14,19-24H2,4H3 |
| InChIKey | JMRRXFNFOURDIX-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.16 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|