C18H30ClN3O2 — CID 142321263
2-chloro-6-[4-(3-hydroxypropyl)piperidin-1-yl]-N,N-dimethylpyridine-3-carboxamide;ethane (PubChem CID 142321263) has the molecular formula C18H30ClN3O2 and a molecular weight of 355.91 g/mol. Its IUPAC name is 2-chloro-6-[4-(3-hydroxypropyl)piperidin-1-yl]-N,N-dimethylpyridine-3-carboxamide;ethane.
| Compound Name | 2-chloro-6-[4-(3-hydroxypropyl)piperidin-1-yl]-N,N-dimethylpyridine-3-carboxamide;ethane |
|---|---|
| PubChem CID | 142321263 |
| Molecular Formula | C18H30ClN3O2 |
| Molecular Weight | 355.91 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | 2-chloro-6-[4-(3-hydroxypropyl)piperidin-1-yl]-N,N-dimethylpyridine-3-carboxamide;ethane |
| SMILES | CC.CN(C)C(=O)c1ccc(N2CCC(CCCO)CC2)nc1Cl |
| InChI | InChI=1S/C16H24ClN3O2.C2H6/c1-19(2)16(22)13-5-6-14(18-15(13)17)20-9-7-12(8-10-20)4-3-11-21;1-2/h5-6,12,21H,3-4,7-11H2,1-2H3;1-2H3 |
| InChIKey | HYXLBOCOFUNEKD-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.91 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|