C25H30ClF3N4O3 — CID 142321357
2-chloro-N,N-dimethyl-6-[4-[3-[[(2S)-3,3,3-trifluoro-2-hydroxy-2-phenylpropanoyl]amino]propyl]piperidin-1-yl]pyridine-3-carboxamide (PubChem CID 142321357) has the molecular formula C25H30ClF3N4O3 and a molecular weight of 526.99 g/mol. Its IUPAC name is 2-chloro-N,N-dimethyl-6-[4-[3-[[(2S)-3,3,3-trifluoro-2-hydroxy-2-phenylpropanoyl]amino]propyl]piperidin-1-yl]pyridine-3-carboxamide.
| Compound Name | 2-chloro-N,N-dimethyl-6-[4-[3-[[(2S)-3,3,3-trifluoro-2-hydroxy-2-phenylpropanoyl]amino]propyl]piperidin-1-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 142321357 |
| Molecular Formula | C25H30ClF3N4O3 |
| Molecular Weight | 526.99 g/mol |
| Exact Mass | 526.20 |
| IUPAC Name | 2-chloro-N,N-dimethyl-6-[4-[3-[[(2S)-3,3,3-trifluoro-2-hydroxy-2-phenylpropanoyl]amino]propyl]piperidin-1-yl]pyridine-3-carboxamide |
| SMILES | CN(C)C(=O)c1ccc(N2CCC(CCCNC(=O)[C@@](O)(c3ccccc3)C(F)(F)F)CC2)nc1Cl |
| InChI | InChI=1S/C25H30ClF3N4O3/c1-32(2)22(34)19-10-11-20(31-21(19)26)33-15-12-17(13-16-33)7-6-14-30-23(35)24(36,25(27,28)29)18-8-4-3-5-9-18/h3-5,8-11,17,36H,6-7,12-16H2,1-2H3,(H,30,35)/t24-/m0/s1 |
| InChIKey | UVATZHRBNFQHNS-DEOSSOPVSA-N |
| XLogP | 4.00 |
| TPSA | 85.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.99 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|