C26H33ClF3N4O4+ — CID 142321242
2-chloro-N,N-dimethyl-6-[4-[3-[[(2R)-3,3,3-trifluoro-2-hydroxy-2-(3-methoxyphenyl)propanoyl]amino]propyl]piperidin-1-ium-1-yl]pyridine-3-carboxamide (PubChem CID 142321242) has the molecular formula C26H33ClF3N4O4+ and a molecular weight of 558.02 g/mol. Its IUPAC name is 2-chloro-N,N-dimethyl-6-[4-[3-[[(2R)-3,3,3-trifluoro-2-hydroxy-2-(3-methoxyphenyl)propanoyl]amino]propyl]piperidin-1-ium-1-yl]pyridine-3-carboxamide.
| Compound Name | 2-chloro-N,N-dimethyl-6-[4-[3-[[(2R)-3,3,3-trifluoro-2-hydroxy-2-(3-methoxyphenyl)propanoyl]amino]propyl]piperidin-1-ium-1-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 142321242 |
| Molecular Formula | C26H33ClF3N4O4+ |
| Molecular Weight | 558.02 g/mol |
| Exact Mass | 557.21 |
| IUPAC Name | 2-chloro-N,N-dimethyl-6-[4-[3-[[(2R)-3,3,3-trifluoro-2-hydroxy-2-(3-methoxyphenyl)propanoyl]amino]propyl]piperidin-1-ium-1-yl]pyridine-3-carboxamide |
| SMILES | COc1cccc([C@@](O)(C(=O)NCCCC2CC[NH+](c3ccc(C(=O)N(C)C)c(Cl)n3)CC2)C(F)(F)F)c1 |
| InChI | InChI=1S/C26H32ClF3N4O4/c1-33(2)23(35)20-9-10-21(32-22(20)27)34-14-11-17(12-15-34)6-5-13-31-24(36)25(37,26(28,29)30)18-7-4-8-19(16-18)38-3/h4,7-10,16-17,37H,5-6,11-15H2,1-3H3,(H,31,36)/p+1/t25-/m1/s1 |
| InChIKey | PSQICGSJHBMYAK-RUZDIDTESA-O |
| XLogP | 2.72 |
| TPSA | 96.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.02 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|