C25H28Cl3F3N4O3 — CID 142321356
2-chloro-6-[4-[3-[[(2R)-2-(3,5-dichlorophenyl)-3,3,3-trifluoro-2-hydroxypropanoyl]amino]propyl]piperidin-1-yl]-N,N-dimethylpyridine-3-carboxamide (PubChem CID 142321356) has the molecular formula C25H28Cl3F3N4O3 and a molecular weight of 595.88 g/mol. Its IUPAC name is 2-chloro-6-[4-[3-[[(2R)-2-(3,5-dichlorophenyl)-3,3,3-trifluoro-2-hydroxypropanoyl]amino]propyl]piperidin-1-yl]-N,N-dimethylpyridine-3-carboxamide.
| Compound Name | 2-chloro-6-[4-[3-[[(2R)-2-(3,5-dichlorophenyl)-3,3,3-trifluoro-2-hydroxypropanoyl]amino]propyl]piperidin-1-yl]-N,N-dimethylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 142321356 |
| Molecular Formula | C25H28Cl3F3N4O3 |
| Molecular Weight | 595.88 g/mol |
| Exact Mass | 594.12 |
| IUPAC Name | 2-chloro-6-[4-[3-[[(2R)-2-(3,5-dichlorophenyl)-3,3,3-trifluoro-2-hydroxypropanoyl]amino]propyl]piperidin-1-yl]-N,N-dimethylpyridine-3-carboxamide |
| SMILES | CN(C)C(=O)c1ccc(N2CCC(CCCNC(=O)[C@](O)(c3cc(Cl)cc(Cl)c3)C(F)(F)F)CC2)nc1Cl |
| InChI | InChI=1S/C25H28Cl3F3N4O3/c1-34(2)22(36)19-5-6-20(33-21(19)28)35-10-7-15(8-11-35)4-3-9-32-23(37)24(38,25(29,30)31)16-12-17(26)14-18(27)13-16/h5-6,12-15,38H,3-4,7-11H2,1-2H3,(H,32,37)/t24-/m1/s1 |
| InChIKey | WHXWFLSJVAACQM-XMMPIXPASA-N |
| XLogP | 5.31 |
| TPSA | 85.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.88 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|