C28H37ClN4O2 — CID 134437536
2-chloro-N,N-dimethyl-6-[4-[3-[(1-phenylcyclopentanecarbonyl)amino]propyl]piperidin-1-yl]pyridine-3-carboxamide (PubChem CID 134437536) has the molecular formula C28H37ClN4O2 and a molecular weight of 497.08 g/mol. Its IUPAC name is 2-chloro-N,N-dimethyl-6-[4-[3-[(1-phenylcyclopentanecarbonyl)amino]propyl]piperidin-1-yl]pyridine-3-carboxamide.
| Compound Name | 2-chloro-N,N-dimethyl-6-[4-[3-[(1-phenylcyclopentanecarbonyl)amino]propyl]piperidin-1-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 134437536 |
| Molecular Formula | C28H37ClN4O2 |
| Molecular Weight | 497.08 g/mol |
| Exact Mass | 496.26 |
| IUPAC Name | 2-chloro-N,N-dimethyl-6-[4-[3-[(1-phenylcyclopentanecarbonyl)amino]propyl]piperidin-1-yl]pyridine-3-carboxamide |
| SMILES | CN(C)C(=O)c1ccc(N2CCC(CCCNC(=O)C3(c4ccccc4)CCCC3)CC2)nc1Cl |
| InChI | InChI=1S/C28H37ClN4O2/c1-32(2)26(34)23-12-13-24(31-25(23)29)33-19-14-21(15-20-33)9-8-18-30-27(35)28(16-6-7-17-28)22-10-4-3-5-11-22/h3-5,10-13,21H,6-9,14-20H2,1-2H3,(H,30,35) |
| InChIKey | QYRSKUMAQQGXDQ-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.08 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|