C25H35ClFN3O3S — CID 166750610
2-chloro-6-[4-[3-[(3S)-3-ethenyl-3-fluoro-2-methyl-1-oxo-5-oxa-2λ4-thiaspiro[3.4]octan-2-yl]propyl]piperidin-1-yl]-N,N-dimethylpyridine-3-carboxamide (PubChem CID 166750610) has the molecular formula C25H35ClFN3O3S and a molecular weight of 512.09 g/mol. Its IUPAC name is 2-chloro-6-[4-[3-[(3S)-3-ethenyl-3-fluoro-2-methyl-1-oxo-5-oxa-2λ4-thiaspiro[3.4]octan-2-yl]propyl]piperidin-1-yl]-N,N-dimethylpyridine-3-carboxamide.
| Compound Name | 2-chloro-6-[4-[3-[(3S)-3-ethenyl-3-fluoro-2-methyl-1-oxo-5-oxa-2λ4-thiaspiro[3.4]octan-2-yl]propyl]piperidin-1-yl]-N,N-dimethylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 166750610 |
| Molecular Formula | C25H35ClFN3O3S |
| Molecular Weight | 512.09 g/mol |
| Exact Mass | 511.21 |
| IUPAC Name | 2-chloro-6-[4-[3-[(3S)-3-ethenyl-3-fluoro-2-methyl-1-oxo-5-oxa-2λ4-thiaspiro[3.4]octan-2-yl]propyl]piperidin-1-yl]-N,N-dimethylpyridine-3-carboxamide |
| SMILES | C=C[C@@]1(F)C2(CCCO2)C(=O)S1(C)CCCC1CCN(c2ccc(C(=O)N(C)C)c(Cl)n2)CC1 |
| InChI | InChI=1S/C25H35ClFN3O3S/c1-5-25(27)24(13-7-16-33-24)23(32)34(25,4)17-6-8-18-11-14-30(15-12-18)20-10-9-19(21(26)28-20)22(31)29(2)3/h5,9-10,18H,1,6-8,11-17H2,2-4H3/t24?,25-/m0/s1 |
| InChIKey | QJPPLYBAKKGDMS-BBMPLOMVSA-N |
| XLogP | 4.81 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.09 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|