C19H29ClN4O — CID 166750593
2-chloro-6-[2-[(dimethylamino)methyl]-7-azaspiro[3.5]nonan-7-yl]-N,N-dimethylpyridine-3-carboxamide (PubChem CID 166750593) has the molecular formula C19H29ClN4O and a molecular weight of 364.92 g/mol. Its IUPAC name is 2-chloro-6-[2-[(dimethylamino)methyl]-7-azaspiro[3.5]nonan-7-yl]-N,N-dimethylpyridine-3-carboxamide.
| Compound Name | 2-chloro-6-[2-[(dimethylamino)methyl]-7-azaspiro[3.5]nonan-7-yl]-N,N-dimethylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 166750593 |
| Molecular Formula | C19H29ClN4O |
| Molecular Weight | 364.92 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | 2-chloro-6-[2-[(dimethylamino)methyl]-7-azaspiro[3.5]nonan-7-yl]-N,N-dimethylpyridine-3-carboxamide |
| SMILES | CN(C)CC1CC2(CCN(c3ccc(C(=O)N(C)C)c(Cl)n3)CC2)C1 |
| InChI | InChI=1S/C19H29ClN4O/c1-22(2)13-14-11-19(12-14)7-9-24(10-8-19)16-6-5-15(17(20)21-16)18(25)23(3)4/h5-6,14H,7-13H2,1-4H3 |
| InChIKey | CBXUZPTZTZTKJV-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 39.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.92 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|