About 4-[3-[(2S)-6-azaspiro[2.5]octan-2-yl]propoxy]-2-chloro-N,N-dimethylbenzamide
4-[3-[(2S)-6-azaspiro[2.5]octan-2-yl]propoxy]-2-chloro-N,N-dimethylbenzamide (PubChem CID 134434143) has the molecular formula C19H27ClN2O2
and a molecular weight of 350.89 g/mol. Its IUPAC name is 4-[3-[(2S)-6-azaspiro[2.5]octan-2-yl]propoxy]-2-chloro-N,N-dimethylbenzamide.
Molecular Properties
| Compound Name | 4-[3-[(2S)-6-azaspiro[2.5]octan-2-yl]propoxy]-2-chloro-N,N-dimethylbenzamide |
| PubChem CID | 134434143 |
| Molecular Formula | C19H27ClN2O2 |
| Molecular Weight | 350.89 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | 4-[3-[(2S)-6-azaspiro[2.5]octan-2-yl]propoxy]-2-chloro-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccc(OCCC[C@H]2CC23CCNCC3)cc1Cl |
| InChI | InChI=1S/C19H27ClN2O2/c1-22(2)18(23)16-6-5-15(12-17(16)20)24-11-3-4-14-13-19(14)7-9-21-10-8-19/h5-6,12,14,21H,3-4,7-11,13H2,1-2H3/t14-/m0/s1 |
| InChIKey | MNPNKUXNHLUOGC-AWEZNQCLSA-N |
| XLogP | 3.59 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.89 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[3-[(2S)-6-azaspiro[2.5]octan-2-yl]propoxy]-2-chloro-N,N-dimethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-[(2S)-6-azaspiro[2.5]octan-2-yl]propoxy]-2-chloro-N,N-dimethylbenzamide?
The IUPAC name of 4-[3-[(2S)-6-azaspiro[2.5]octan-2-yl]propoxy]-2-chloro-N,N-dimethylbenzamide (CID 134434143) is 4-[3-[(2S)-6-azaspiro[2.5]octan-2-yl]propoxy]-2-chloro-N,N-dimethylbenzamide.
What is the SMILES notation for 4-[3-[(2S)-6-azaspiro[2.5]octan-2-yl]propoxy]-2-chloro-N,N-dimethylbenzamide?
The canonical SMILES for 4-[3-[(2S)-6-azaspiro[2.5]octan-2-yl]propoxy]-2-chloro-N,N-dimethylbenzamide is CN(C)C(=O)c1ccc(OCCC[C@H]2CC23CCNCC3)cc1Cl.
What is the InChIKey of 4-[3-[(2S)-6-azaspiro[2.5]octan-2-yl]propoxy]-2-chloro-N,N-dimethylbenzamide?
The InChIKey is MNPNKUXNHLUOGC-AWEZNQCLSA-N. The full InChI is InChI=1S/C19H27ClN2O2/c1-22(2)18(23)16-6-5-15(12-17(16)20)24-11-3-4-14-13-19(14)7-9-21-10-8-19/h5-6,12,14,21H,3-4,7-11,13H2,1-2H3/t14-/m0/s1.
What are the key properties of 4-[3-[(2S)-6-azaspiro[2.5]octan-2-yl]propoxy]-2-chloro-N,N-dimethylbenzamide?
4-[3-[(2S)-6-azaspiro[2.5]octan-2-yl]propoxy]-2-chloro-N,N-dimethylbenzamide has a molecular weight of 350.89 g/mol, XLogP of 3.59, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-[(2S)-6-azaspiro[2.5]octan-2-yl]propoxy]-2-chloro-N,N-dimethylbenzamide is sourced from PubChem (CID 134434143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).