C23H33ClF2N2O4 — CID 155024346
2-tert-butyl-4-[4-[3-chloro-4-(dimethylcarbamoyl)phenoxy]-1,1-difluorobutyl]piperidine-1-carboxylic acid (PubChem CID 155024346) has the molecular formula C23H33ClF2N2O4 and a molecular weight of 474.98 g/mol. Its IUPAC name is 2-tert-butyl-4-[4-[3-chloro-4-(dimethylcarbamoyl)phenoxy]-1,1-difluorobutyl]piperidine-1-carboxylic acid.
| Compound Name | 2-tert-butyl-4-[4-[3-chloro-4-(dimethylcarbamoyl)phenoxy]-1,1-difluorobutyl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 155024346 |
| Molecular Formula | C23H33ClF2N2O4 |
| Molecular Weight | 474.98 g/mol |
| Exact Mass | 474.21 |
| IUPAC Name | 2-tert-butyl-4-[4-[3-chloro-4-(dimethylcarbamoyl)phenoxy]-1,1-difluorobutyl]piperidine-1-carboxylic acid |
| SMILES | CN(C)C(=O)c1ccc(OCCCC(F)(F)C2CCN(C(=O)O)C(C(C)(C)C)C2)cc1Cl |
| InChI | InChI=1S/C23H33ClF2N2O4/c1-22(2,3)19-13-15(9-11-28(19)21(30)31)23(25,26)10-6-12-32-16-7-8-17(18(24)14-16)20(29)27(4)5/h7-8,14-15,19H,6,9-13H2,1-5H3,(H,30,31) |
| InChIKey | WHTNCXMETSMLNJ-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.98 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|