About 2-chloro-4-(4,4-difluoro-5-propyloct-7-enoxy)-N,N-dimethylbenzamide
2-chloro-4-(4,4-difluoro-5-propyloct-7-enoxy)-N,N-dimethylbenzamide (PubChem CID 142321132) has the molecular formula C20H28ClF2NO2
and a molecular weight of 387.90 g/mol. Its IUPAC name is 2-chloro-4-(4,4-difluoro-5-propyloct-7-enoxy)-N,N-dimethylbenzamide.
Molecular Properties
| Compound Name | 2-chloro-4-(4,4-difluoro-5-propyloct-7-enoxy)-N,N-dimethylbenzamide |
| PubChem CID | 142321132 |
| Molecular Formula | C20H28ClF2NO2 |
| Molecular Weight | 387.90 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | 2-chloro-4-(4,4-difluoro-5-propyloct-7-enoxy)-N,N-dimethylbenzamide |
| SMILES | C=CCC(CCC)C(F)(F)CCCOc1ccc(C(=O)N(C)C)c(Cl)c1 |
| InChI | InChI=1S/C20H28ClF2NO2/c1-5-8-15(9-6-2)20(22,23)12-7-13-26-16-10-11-17(18(21)14-16)19(25)24(3)4/h5,10-11,14-15H,1,6-9,12-13H2,2-4H3 |
| InChIKey | CQVSLCDOUKPUPT-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 387.90 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-4-(4,4-difluoro-5-propyloct-7-enoxy)-N,N-dimethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4-(4,4-difluoro-5-propyloct-7-enoxy)-N,N-dimethylbenzamide?
The IUPAC name of 2-chloro-4-(4,4-difluoro-5-propyloct-7-enoxy)-N,N-dimethylbenzamide (CID 142321132) is 2-chloro-4-(4,4-difluoro-5-propyloct-7-enoxy)-N,N-dimethylbenzamide.
What is the SMILES notation for 2-chloro-4-(4,4-difluoro-5-propyloct-7-enoxy)-N,N-dimethylbenzamide?
The canonical SMILES for 2-chloro-4-(4,4-difluoro-5-propyloct-7-enoxy)-N,N-dimethylbenzamide is C=CCC(CCC)C(F)(F)CCCOc1ccc(C(=O)N(C)C)c(Cl)c1.
What is the InChIKey of 2-chloro-4-(4,4-difluoro-5-propyloct-7-enoxy)-N,N-dimethylbenzamide?
The InChIKey is CQVSLCDOUKPUPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H28ClF2NO2/c1-5-8-15(9-6-2)20(22,23)12-7-13-26-16-10-11-17(18(21)14-16)19(25)24(3)4/h5,10-11,14-15H,1,6-9,12-13H2,2-4H3.
What are the key properties of 2-chloro-4-(4,4-difluoro-5-propyloct-7-enoxy)-N,N-dimethylbenzamide?
2-chloro-4-(4,4-difluoro-5-propyloct-7-enoxy)-N,N-dimethylbenzamide has a molecular weight of 387.90 g/mol, XLogP of 5.83, 11 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-(4,4-difluoro-5-propyloct-7-enoxy)-N,N-dimethylbenzamide is sourced from PubChem (CID 142321132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).