About 2-chloro-4-[1,1-difluoro-3-methyl-4-(1-methylpiperidin-4-yl)butoxy]-N,N-dimethylbenzamide
2-chloro-4-[1,1-difluoro-3-methyl-4-(1-methylpiperidin-4-yl)butoxy]-N,N-dimethylbenzamide (PubChem CID 134434114) has the molecular formula C20H29ClF2N2O2
and a molecular weight of 402.91 g/mol. Its IUPAC name is 2-chloro-4-[1,1-difluoro-3-methyl-4-(1-methylpiperidin-4-yl)butoxy]-N,N-dimethylbenzamide.
Molecular Properties
| Compound Name | 2-chloro-4-[1,1-difluoro-3-methyl-4-(1-methylpiperidin-4-yl)butoxy]-N,N-dimethylbenzamide |
| PubChem CID | 134434114 |
| Molecular Formula | C20H29ClF2N2O2 |
| Molecular Weight | 402.91 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | 2-chloro-4-[1,1-difluoro-3-methyl-4-(1-methylpiperidin-4-yl)butoxy]-N,N-dimethylbenzamide |
| SMILES | CC(CC1CCN(C)CC1)CC(F)(F)Oc1ccc(C(=O)N(C)C)c(Cl)c1 |
| InChI | InChI=1S/C20H29ClF2N2O2/c1-14(11-15-7-9-25(4)10-8-15)13-20(22,23)27-16-5-6-17(18(21)12-16)19(26)24(2)3/h5-6,12,14-15H,7-11,13H2,1-4H3 |
| InChIKey | JTEIBDDECGREGW-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.91 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-chloro-4-[1,1-difluoro-3-methyl-4-(1-methylpiperidin-4-yl)butoxy]-N,N-dimethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4-[1,1-difluoro-3-methyl-4-(1-methylpiperidin-4-yl)butoxy]-N,N-dimethylbenzamide?
The IUPAC name of 2-chloro-4-[1,1-difluoro-3-methyl-4-(1-methylpiperidin-4-yl)butoxy]-N,N-dimethylbenzamide (CID 134434114) is 2-chloro-4-[1,1-difluoro-3-methyl-4-(1-methylpiperidin-4-yl)butoxy]-N,N-dimethylbenzamide.
What is the SMILES notation for 2-chloro-4-[1,1-difluoro-3-methyl-4-(1-methylpiperidin-4-yl)butoxy]-N,N-dimethylbenzamide?
The canonical SMILES for 2-chloro-4-[1,1-difluoro-3-methyl-4-(1-methylpiperidin-4-yl)butoxy]-N,N-dimethylbenzamide is CC(CC1CCN(C)CC1)CC(F)(F)Oc1ccc(C(=O)N(C)C)c(Cl)c1.
What is the InChIKey of 2-chloro-4-[1,1-difluoro-3-methyl-4-(1-methylpiperidin-4-yl)butoxy]-N,N-dimethylbenzamide?
The InChIKey is JTEIBDDECGREGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H29ClF2N2O2/c1-14(11-15-7-9-25(4)10-8-15)13-20(22,23)27-16-5-6-17(18(21)12-16)19(26)24(2)3/h5-6,12,14-15H,7-11,13H2,1-4H3.
What are the key properties of 2-chloro-4-[1,1-difluoro-3-methyl-4-(1-methylpiperidin-4-yl)butoxy]-N,N-dimethylbenzamide?
2-chloro-4-[1,1-difluoro-3-methyl-4-(1-methylpiperidin-4-yl)butoxy]-N,N-dimethylbenzamide has a molecular weight of 402.91 g/mol, XLogP of 4.77, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-[1,1-difluoro-3-methyl-4-(1-methylpiperidin-4-yl)butoxy]-N,N-dimethylbenzamide is sourced from PubChem (CID 134434114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).