C17H24Cl2N2O2 — CID 153291106
4-[3-(6-azaspiro[2.5]octan-2-yl)propylamino]-2-chlorobenzoic acid;hydrochloride (PubChem CID 153291106) has the molecular formula C17H24Cl2N2O2 and a molecular weight of 359.30 g/mol. Its IUPAC name is 4-[3-(6-azaspiro[2.5]octan-2-yl)propylamino]-2-chlorobenzoic acid;hydrochloride.
| Compound Name | 4-[3-(6-azaspiro[2.5]octan-2-yl)propylamino]-2-chlorobenzoic acid;hydrochloride |
|---|---|
| PubChem CID | 153291106 |
| Molecular Formula | C17H24Cl2N2O2 |
| Molecular Weight | 359.30 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | 4-[3-(6-azaspiro[2.5]octan-2-yl)propylamino]-2-chlorobenzoic acid;hydrochloride |
| SMILES | Cl.O=C(O)c1ccc(NCCCC2CC23CCNCC3)cc1Cl |
| InChI | InChI=1S/C17H23ClN2O2.ClH/c18-15-10-13(3-4-14(15)16(21)22)20-7-1-2-12-11-17(12)5-8-19-9-6-17;/h3-4,10,12,19-20H,1-2,5-9,11H2,(H,21,22);1H |
| InChIKey | DVQZOMBXYQBZLP-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.30 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|