C9H20Cl2N2O3 — CID 146155823
2-amino-3-methyl-3-morpholin-4-ylbutanoic acid;dihydrochloride (PubChem CID 146155823) has the molecular formula C9H20Cl2N2O3 and a molecular weight of 275.18 g/mol. Its IUPAC name is 2-amino-3-methyl-3-morpholin-4-ylbutanoic acid;dihydrochloride.
| Compound Name | 2-amino-3-methyl-3-morpholin-4-ylbutanoic acid;dihydrochloride |
|---|---|
| PubChem CID | 146155823 |
| Molecular Formula | C9H20Cl2N2O3 |
| Molecular Weight | 275.18 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | 2-amino-3-methyl-3-morpholin-4-ylbutanoic acid;dihydrochloride |
| SMILES | CC(C)(C(N)C(=O)O)N1CCOCC1.Cl.Cl |
| InChI | InChI=1S/C9H18N2O3.2ClH/c1-9(2,7(10)8(12)13)11-3-5-14-6-4-11;;/h7H,3-6,10H2,1-2H3,(H,12,13);2*1H |
| InChIKey | MUHDRMZVGIJGAR-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.18 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |