C20H28O9 — CID 146158095
(1R,2R,13S,17R)-2,3,11,12,15,16-hexahydroxy-9,13,17-trimethyl-5,18-dioxapentacyclo[12.5.0.01,6.02,17.08,13]nonadec-9-en-4-one (PubChem CID 146158095) has the molecular formula C20H28O9 and a molecular weight of 412.44 g/mol. Its IUPAC name is (1R,2R,13S,17R)-2,3,11,12,15,16-hexahydroxy-9,13,17-trimethyl-5,18-dioxapentacyclo[12.5.0.01,6.02,17.08,13]nonadec-9-en-4-one.
| Compound Name | (1R,2R,13S,17R)-2,3,11,12,15,16-hexahydroxy-9,13,17-trimethyl-5,18-dioxapentacyclo[12.5.0.01,6.02,17.08,13]nonadec-9-en-4-one |
|---|---|
| PubChem CID | 146158095 |
| Molecular Formula | C20H28O9 |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | (1R,2R,13S,17R)-2,3,11,12,15,16-hexahydroxy-9,13,17-trimethyl-5,18-dioxapentacyclo[12.5.0.01,6.02,17.08,13]nonadec-9-en-4-one |
| SMILES | CC1=CC(O)C(O)[C@@]2(C)C1CC1OC(=O)C(O)[C@]3(O)[C@]14CO[C@]3(C)C(O)C(O)C24 |
| InChI | InChI=1S/C20H28O9/c1-7-4-9(21)13(23)17(2)8(7)5-10-19-6-28-18(3,14(24)11(22)12(17)19)20(19,27)15(25)16(26)29-10/h4,8-15,21-25,27H,5-6H2,1-3H3/t8?,9?,10?,11?,12?,13?,14?,15?,17-,18+,19+,20+/m0/s1 |
| InChIKey | ZBXITHPYBBXZRG-YPKSKYOXSA-N |
| XLogP | -2.16 |
| TPSA | 156.91 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | -2.16 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|