C20H28O8 — CID 46236724
(2S,3S,7S,9R,12R,13R,14S,15R,16R,17S)-3,12,13,15,16-pentahydroxy-2,6,14,17-tetramethyl-10-oxatetracyclo[7.7.1.02,7.013,17]heptadec-5-ene-4,11-dione (PubChem CID 46236724) has the molecular formula C20H28O8 and a molecular weight of 396.44 g/mol. Its IUPAC name is (2S,3S,7S,9R,12R,13R,14S,15R,16R,17S)-3,12,13,15,16-pentahydroxy-2,6,14,17-tetramethyl-10-oxatetracyclo[7.7.1.02,7.013,17]heptadec-5-ene-4,11-dione.
| Compound Name | (2S,3S,7S,9R,12R,13R,14S,15R,16R,17S)-3,12,13,15,16-pentahydroxy-2,6,14,17-tetramethyl-10-oxatetracyclo[7.7.1.02,7.013,17]heptadec-5-ene-4,11-dione |
|---|---|
| PubChem CID | 46236724 |
| Molecular Formula | C20H28O8 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | (2S,3S,7S,9R,12R,13R,14S,15R,16R,17S)-3,12,13,15,16-pentahydroxy-2,6,14,17-tetramethyl-10-oxatetracyclo[7.7.1.02,7.013,17]heptadec-5-ene-4,11-dione |
| SMILES | CC1=CC(=O)[C@@H](O)[C@]2(C)C3C(O)[C@H](O)[C@H](C)[C@]4(O)[C@@H](O)C(=O)O[C@H](C[C@@H]12)[C@]34C |
| InChI | InChI=1S/C20H28O8/c1-7-5-10(21)15(24)18(3)9(7)6-11-19(4)14(18)13(23)12(22)8(2)20(19,27)16(25)17(26)28-11/h5,8-9,11-16,22-25,27H,6H2,1-4H3/t8-,9-,11+,12+,13?,14?,15+,16-,18-,19+,20-/m0/s1 |
| InChIKey | NWNMAVFXIRDAPM-LZZXWSHGSA-N |
| XLogP | -1.09 |
| TPSA | 144.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |