C21H32O8 — CID 163028636
3,4,12,13,15,16-hexahydroxy-2,6,8,14,17-pentamethyl-10-oxatetracyclo[7.7.1.02,7.013,17]heptadec-6-en-11-one (PubChem CID 163028636) has the molecular formula C21H32O8 and a molecular weight of 412.48 g/mol. Its IUPAC name is 3,4,12,13,15,16-hexahydroxy-2,6,8,14,17-pentamethyl-10-oxatetracyclo[7.7.1.02,7.013,17]heptadec-6-en-11-one.
| Compound Name | 3,4,12,13,15,16-hexahydroxy-2,6,8,14,17-pentamethyl-10-oxatetracyclo[7.7.1.02,7.013,17]heptadec-6-en-11-one |
|---|---|
| PubChem CID | 163028636 |
| Molecular Formula | C21H32O8 |
| Molecular Weight | 412.48 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | 3,4,12,13,15,16-hexahydroxy-2,6,8,14,17-pentamethyl-10-oxatetracyclo[7.7.1.02,7.013,17]heptadec-6-en-11-one |
| SMILES | CC1=C2C(C)C3OC(=O)C(O)C4(O)C(C)C(O)C(O)C(C2(C)C(O)C(O)C1)C34C |
| InChI | InChI=1S/C21H32O8/c1-7-6-10(22)15(25)19(4)11(7)8(2)17-20(5)14(19)13(24)12(23)9(3)21(20,28)16(26)18(27)29-17/h8-10,12-17,22-26,28H,6H2,1-5H3 |
| InChIKey | ZGNIDKSDDMXYIC-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 147.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.48 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|