C20H24O6 — CID 163190797
(1S,4R,5R,7S,11R,13S,17S,18S,19R)-5,17-dihydroxy-14,18-dimethyl-6-methylidene-3,10-dioxapentacyclo[9.8.0.01,7.04,19.013,18]nonadec-14-ene-9,16-dione (PubChem CID 163190797) has the molecular formula C20H24O6 and a molecular weight of 360.41 g/mol. Its IUPAC name is (1S,4R,5R,7S,11R,13S,17S,18S,19R)-5,17-dihydroxy-14,18-dimethyl-6-methylidene-3,10-dioxapentacyclo[9.8.0.01,7.04,19.013,18]nonadec-14-ene-9,16-dione.
| Compound Name | (1S,4R,5R,7S,11R,13S,17S,18S,19R)-5,17-dihydroxy-14,18-dimethyl-6-methylidene-3,10-dioxapentacyclo[9.8.0.01,7.04,19.013,18]nonadec-14-ene-9,16-dione |
|---|---|
| PubChem CID | 163190797 |
| Molecular Formula | C20H24O6 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | (1S,4R,5R,7S,11R,13S,17S,18S,19R)-5,17-dihydroxy-14,18-dimethyl-6-methylidene-3,10-dioxapentacyclo[9.8.0.01,7.04,19.013,18]nonadec-14-ene-9,16-dione |
| SMILES | C=C1[C@@H](O)[C@@H]2OC[C@]34[C@H]2[C@@]2(C)[C@H](O)C(=O)C=C(C)[C@@H]2C[C@H]3OC(=O)C[C@@H]14 |
| InChI | InChI=1S/C20H24O6/c1-8-4-12(21)18(24)19(3)10(8)5-13-20-7-25-16(17(19)20)15(23)9(2)11(20)6-14(22)26-13/h4,10-11,13,15-18,23-24H,2,5-7H2,1,3H3/t10-,11-,13+,15+,16-,17+,18+,19-,20+/m0/s1 |
| InChIKey | ZYKXSWCKEJLGFS-JRIJYUSFSA-N |
| XLogP | 0.77 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|