C22H32N4O3 — CID 146158484
4-morpholin-4-yl-N-[4-(4-oxo-2,3,4a,5,6,7,8,8a-octahydro-1H-phthalazin-1-yl)phenyl]butanamide (PubChem CID 146158484) has the molecular formula C22H32N4O3 and a molecular weight of 400.52 g/mol. Its IUPAC name is 4-morpholin-4-yl-N-[4-(4-oxo-2,3,4a,5,6,7,8,8a-octahydro-1H-phthalazin-1-yl)phenyl]butanamide.
| Compound Name | 4-morpholin-4-yl-N-[4-(4-oxo-2,3,4a,5,6,7,8,8a-octahydro-1H-phthalazin-1-yl)phenyl]butanamide |
|---|---|
| PubChem CID | 146158484 |
| Molecular Formula | C22H32N4O3 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.25 |
| IUPAC Name | 4-morpholin-4-yl-N-[4-(4-oxo-2,3,4a,5,6,7,8,8a-octahydro-1H-phthalazin-1-yl)phenyl]butanamide |
| SMILES | O=C(CCCN1CCOCC1)Nc1ccc(C2NNC(=O)C3CCCCC32)cc1 |
| InChI | InChI=1S/C22H32N4O3/c27-20(6-3-11-26-12-14-29-15-13-26)23-17-9-7-16(8-10-17)21-18-4-1-2-5-19(18)22(28)25-24-21/h7-10,18-19,21,24H,1-6,11-15H2,(H,23,27)(H,25,28) |
| InChIKey | ZYNQSWKIENXZIZ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |