C27H45NO5 — CID 146159862
(10S,14R,23R)-6,10,23-trimethyl-4-azahexacyclo[12.11.0.02,11.04,9.015,24.018,23]pentacosane-10,12,14,17,20-pentol (PubChem CID 146159862) has the molecular formula C27H45NO5 and a molecular weight of 463.66 g/mol. Its IUPAC name is (10S,14R,23R)-6,10,23-trimethyl-4-azahexacyclo[12.11.0.02,11.04,9.015,24.018,23]pentacosane-10,12,14,17,20-pentol.
| Compound Name | (10S,14R,23R)-6,10,23-trimethyl-4-azahexacyclo[12.11.0.02,11.04,9.015,24.018,23]pentacosane-10,12,14,17,20-pentol |
|---|---|
| PubChem CID | 146159862 |
| Molecular Formula | C27H45NO5 |
| Molecular Weight | 463.66 g/mol |
| Exact Mass | 463.33 |
| IUPAC Name | (10S,14R,23R)-6,10,23-trimethyl-4-azahexacyclo[12.11.0.02,11.04,9.015,24.018,23]pentacosane-10,12,14,17,20-pentol |
| SMILES | CC1CCC2N(C1)CC1C(C(O)C[C@]3(O)C1CC1C3CC(O)C3CC(O)CC[C@@]31C)[C@]2(C)O |
| InChI | InChI=1S/C27H45NO5/c1-14-4-5-23-26(3,32)24-16(13-28(23)12-14)17-9-18-19(27(17,33)11-22(24)31)10-21(30)20-8-15(29)6-7-25(18,20)2/h14-24,29-33H,4-13H2,1-3H3/t14?,15?,16?,17?,18?,19?,20?,21?,22?,23?,24?,25-,26-,27+/m1/s1 |
| InChIKey | IDFMBIWPULRZOJ-IAXPBYHHSA-N |
| XLogP | 1.76 |
| TPSA | 104.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.66 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |