About (4-bromo-3-methoxycarbonylpyrazolo[1,5-a]pyridin-6-yl)boronic acid
(4-bromo-3-methoxycarbonylpyrazolo[1,5-a]pyridin-6-yl)boronic acid (PubChem CID 146160587) has the molecular formula C9H8BBrN2O4
and a molecular weight of 298.89 g/mol. Its IUPAC name is (4-bromo-3-methoxycarbonylpyrazolo[1,5-a]pyridin-6-yl)boronic acid.
Molecular Properties
| Compound Name | (4-bromo-3-methoxycarbonylpyrazolo[1,5-a]pyridin-6-yl)boronic acid |
| PubChem CID | 146160587 |
| Molecular Formula | C9H8BBrN2O4 |
| Molecular Weight | 298.89 g/mol |
| Exact Mass | 297.98 |
| IUPAC Name | (4-bromo-3-methoxycarbonylpyrazolo[1,5-a]pyridin-6-yl)boronic acid |
| SMILES | COC(=O)c1cnn2cc(B(O)O)cc(Br)c12 |
| InChI | InChI=1S/C9H8BBrN2O4/c1-17-9(14)6-3-12-13-4-5(10(15)16)2-7(11)8(6)13/h2-4,15-16H,1H3 |
| InChIKey | JWDCRMWUKIXUAP-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.89 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (4-bromo-3-methoxycarbonylpyrazolo[1,5-a]pyridin-6-yl)boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-bromo-3-methoxycarbonylpyrazolo[1,5-a]pyridin-6-yl)boronic acid?
The IUPAC name of (4-bromo-3-methoxycarbonylpyrazolo[1,5-a]pyridin-6-yl)boronic acid (CID 146160587) is (4-bromo-3-methoxycarbonylpyrazolo[1,5-a]pyridin-6-yl)boronic acid.
What is the SMILES notation for (4-bromo-3-methoxycarbonylpyrazolo[1,5-a]pyridin-6-yl)boronic acid?
The canonical SMILES for (4-bromo-3-methoxycarbonylpyrazolo[1,5-a]pyridin-6-yl)boronic acid is COC(=O)c1cnn2cc(B(O)O)cc(Br)c12.
What is the InChIKey of (4-bromo-3-methoxycarbonylpyrazolo[1,5-a]pyridin-6-yl)boronic acid?
The InChIKey is JWDCRMWUKIXUAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8BBrN2O4/c1-17-9(14)6-3-12-13-4-5(10(15)16)2-7(11)8(6)13/h2-4,15-16H,1H3.
What are the key properties of (4-bromo-3-methoxycarbonylpyrazolo[1,5-a]pyridin-6-yl)boronic acid?
(4-bromo-3-methoxycarbonylpyrazolo[1,5-a]pyridin-6-yl)boronic acid has a molecular weight of 298.89 g/mol, XLogP of -0.44, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-bromo-3-methoxycarbonylpyrazolo[1,5-a]pyridin-6-yl)boronic acid is sourced from PubChem (CID 146160587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).