C18H20N2O3 — CID 146161521
1-[(3-amino-4-methoxyphenyl)methyl]-7-methoxy-3,4-dihydroisoquinolin-8-ol (PubChem CID 146161521) has the molecular formula C18H20N2O3 and a molecular weight of 312.37 g/mol. Its IUPAC name is 1-[(3-amino-4-methoxyphenyl)methyl]-7-methoxy-3,4-dihydroisoquinolin-8-ol.
| Compound Name | 1-[(3-amino-4-methoxyphenyl)methyl]-7-methoxy-3,4-dihydroisoquinolin-8-ol |
|---|---|
| PubChem CID | 146161521 |
| Molecular Formula | C18H20N2O3 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | 1-[(3-amino-4-methoxyphenyl)methyl]-7-methoxy-3,4-dihydroisoquinolin-8-ol |
| SMILES | COc1ccc(CC2=NCCc3ccc(OC)c(O)c32)cc1N |
| InChI | InChI=1S/C18H20N2O3/c1-22-15-5-3-11(9-13(15)19)10-14-17-12(7-8-20-14)4-6-16(23-2)18(17)21/h3-6,9,21H,7-8,10,19H2,1-2H3 |
| InChIKey | YIDKAPTULBIFLO-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 77.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|