C13H21Cl2N3O2 — CID 141346456
N-[(3-amino-4-methoxyphenyl)methoxy]-2,3,4,5-tetrahydropyridin-6-amine;dihydrochloride (PubChem CID 141346456) has the molecular formula C13H21Cl2N3O2 and a molecular weight of 322.24 g/mol. Its IUPAC name is N-[(3-amino-4-methoxyphenyl)methoxy]-2,3,4,5-tetrahydropyridin-6-amine;dihydrochloride.
| Compound Name | N-[(3-amino-4-methoxyphenyl)methoxy]-2,3,4,5-tetrahydropyridin-6-amine;dihydrochloride |
|---|---|
| PubChem CID | 141346456 |
| Molecular Formula | C13H21Cl2N3O2 |
| Molecular Weight | 322.24 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | N-[(3-amino-4-methoxyphenyl)methoxy]-2,3,4,5-tetrahydropyridin-6-amine;dihydrochloride |
| SMILES | COc1ccc(CONC2=NCCCC2)cc1N.Cl.Cl |
| InChI | InChI=1S/C13H19N3O2.2ClH/c1-17-12-6-5-10(8-11(12)14)9-18-16-13-4-2-3-7-15-13;;/h5-6,8H,2-4,7,9,14H2,1H3,(H,15,16);2*1H |
| InChIKey | KKOVZUVGZAOVBB-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.24 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|