C12H14N4O — CID 82474391
2-methoxy-5-[2-(1,3,5-triazin-2-yl)ethyl]aniline (PubChem CID 82474391) has the molecular formula C12H14N4O and a molecular weight of 230.27 g/mol. Its IUPAC name is 2-methoxy-5-[2-(1,3,5-triazin-2-yl)ethyl]aniline.
| Compound Name | 2-methoxy-5-[2-(1,3,5-triazin-2-yl)ethyl]aniline |
|---|---|
| PubChem CID | 82474391 |
| Molecular Formula | C12H14N4O |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | 2-methoxy-5-[2-(1,3,5-triazin-2-yl)ethyl]aniline |
| SMILES | COc1ccc(CCc2ncncn2)cc1N |
| InChI | InChI=1S/C12H14N4O/c1-17-11-4-2-9(6-10(11)13)3-5-12-15-7-14-8-16-12/h2,4,6-8H,3,5,13H2,1H3 |
| InChIKey | QKYOOTBCLMBNLH-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 73.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|