C15H28O2Si — CID 146161559
(Z,5S)-9-[tert-butyl(dimethyl)silyl]oxynon-3-en-1-yn-5-ol (PubChem CID 146161559) has the molecular formula C15H28O2Si and a molecular weight of 268.47 g/mol. Its IUPAC name is (Z,5S)-9-[tert-butyl(dimethyl)silyl]oxynon-3-en-1-yn-5-ol.
| Compound Name | (Z,5S)-9-[tert-butyl(dimethyl)silyl]oxynon-3-en-1-yn-5-ol |
|---|---|
| PubChem CID | 146161559 |
| Molecular Formula | C15H28O2Si |
| Molecular Weight | 268.47 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | (Z,5S)-9-[tert-butyl(dimethyl)silyl]oxynon-3-en-1-yn-5-ol |
| SMILES | C#C/C=C\[C@@H](O)CCCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H28O2Si/c1-7-8-11-14(16)12-9-10-13-17-18(5,6)15(2,3)4/h1,8,11,14,16H,9-10,12-13H2,2-6H3/b11-8-/t14-/m1/s1 |
| InChIKey | UOVXWVIYHKZNNU-KOTGUFOOSA-N |
| XLogP | 3.73 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.47 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|