C12H17NO — CID 146161884
(1S,8R)-7-methylidene-5-azatricyclo[6.3.1.01,5]dodecan-9-one (PubChem CID 146161884) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is (1S,8R)-7-methylidene-5-azatricyclo[6.3.1.01,5]dodecan-9-one.
| Compound Name | (1S,8R)-7-methylidene-5-azatricyclo[6.3.1.01,5]dodecan-9-one |
|---|---|
| PubChem CID | 146161884 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | (1S,8R)-7-methylidene-5-azatricyclo[6.3.1.01,5]dodecan-9-one |
| SMILES | C=C1CN2CCC[C@@]23CCC(=O)[C@@H]1C3 |
| InChI | InChI=1S/C12H17NO/c1-9-8-13-6-2-4-12(13)5-3-11(14)10(9)7-12/h10H,1-8H2/t10-,12+/m1/s1 |
| InChIKey | DPEDQPVSZWXBRS-PWSUYJOCSA-N |
| XLogP | 1.76 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|