C14H15N3O2 — CID 146161889
6-butyl-1,6,8-triazatricyclo[7.4.0.03,7]trideca-3(7),8,10,12-tetraene-2,5-dione (PubChem CID 146161889) has the molecular formula C14H15N3O2 and a molecular weight of 257.29 g/mol. Its IUPAC name is 6-butyl-1,6,8-triazatricyclo[7.4.0.03,7]trideca-3(7),8,10,12-tetraene-2,5-dione.
| Compound Name | 6-butyl-1,6,8-triazatricyclo[7.4.0.03,7]trideca-3(7),8,10,12-tetraene-2,5-dione |
|---|---|
| PubChem CID | 146161889 |
| Molecular Formula | C14H15N3O2 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 6-butyl-1,6,8-triazatricyclo[7.4.0.03,7]trideca-3(7),8,10,12-tetraene-2,5-dione |
| SMILES | CCCCN1C(=O)Cc2c1nc1ccccn1c2=O |
| InChI | InChI=1S/C14H15N3O2/c1-2-3-7-17-12(18)9-10-13(17)15-11-6-4-5-8-16(11)14(10)19/h4-6,8H,2-3,7,9H2,1H3 |
| InChIKey | FXAUESAPTDXMKJ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 54.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |