C13H14N4O2 — CID 13142825
5,7,12-trimethyl-1,5,7,9-tetrazatricyclo[8.4.0.03,8]tetradeca-3(8),9,11,13-tetraene-4,6-dione (PubChem CID 13142825) has the molecular formula C13H14N4O2 and a molecular weight of 258.28 g/mol. Its IUPAC name is 5,7,12-trimethyl-1,5,7,9-tetrazatricyclo[8.4.0.03,8]tetradeca-3(8),9,11,13-tetraene-4,6-dione.
| Compound Name | 5,7,12-trimethyl-1,5,7,9-tetrazatricyclo[8.4.0.03,8]tetradeca-3(8),9,11,13-tetraene-4,6-dione |
|---|---|
| PubChem CID | 13142825 |
| Molecular Formula | C13H14N4O2 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | 5,7,12-trimethyl-1,5,7,9-tetrazatricyclo[8.4.0.03,8]tetradeca-3(8),9,11,13-tetraene-4,6-dione |
| SMILES | CC1=CC2=Nc3c(c(=O)n(C)c(=O)n3C)CN2C=C1 |
| InChI | InChI=1S/C13H14N4O2/c1-8-4-5-17-7-9-11(14-10(17)6-8)15(2)13(19)16(3)12(9)18/h4-6H,7H2,1-3H3 |
| InChIKey | NGSWWZCZQWCHTB-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 59.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |