C16H23NO2 — CID 146162282
ethyl (E,2S)-2-amino-5-phenyl-2-propan-2-ylpent-4-enoate (PubChem CID 146162282) has the molecular formula C16H23NO2 and a molecular weight of 261.37 g/mol. Its IUPAC name is ethyl (E,2S)-2-amino-5-phenyl-2-propan-2-ylpent-4-enoate.
| Compound Name | ethyl (E,2S)-2-amino-5-phenyl-2-propan-2-ylpent-4-enoate |
|---|---|
| PubChem CID | 146162282 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | ethyl (E,2S)-2-amino-5-phenyl-2-propan-2-ylpent-4-enoate |
| SMILES | CCOC(=O)[C@](N)(C/C=C/c1ccccc1)C(C)C |
| InChI | InChI=1S/C16H23NO2/c1-4-19-15(18)16(17,13(2)3)12-8-11-14-9-6-5-7-10-14/h5-11,13H,4,12,17H2,1-3H3/b11-8+/t16-/m0/s1 |
| InChIKey | AXHRPMVYUJPSHK-KXKDPZRNSA-N |
| XLogP | 3.01 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |