C8H4ClF3N2O2 — CID 146162302
6-chloro-5-(2,2,2-trifluoro-1,1-dihydroxyethyl)pyridine-3-carbonitrile (PubChem CID 146162302) has the molecular formula C8H4ClF3N2O2 and a molecular weight of 252.58 g/mol. Its IUPAC name is 6-chloro-5-(2,2,2-trifluoro-1,1-dihydroxyethyl)pyridine-3-carbonitrile.
| Compound Name | 6-chloro-5-(2,2,2-trifluoro-1,1-dihydroxyethyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 146162302 |
| Molecular Formula | C8H4ClF3N2O2 |
| Molecular Weight | 252.58 g/mol |
| Exact Mass | 251.99 |
| IUPAC Name | 6-chloro-5-(2,2,2-trifluoro-1,1-dihydroxyethyl)pyridine-3-carbonitrile |
| SMILES | N#Cc1cnc(Cl)c(C(O)(O)C(F)(F)F)c1 |
| InChI | InChI=1S/C8H4ClF3N2O2/c9-6-5(1-4(2-13)3-14-6)7(15,16)8(10,11)12/h1,3,15-16H |
| InChIKey | WBNAXYNVFKTPRP-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 77.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.58 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|