C14H26O2Si — CID 146162326
(E,4S)-4-[tert-butyl(dimethyl)silyl]oxyoct-5-en-7-yn-1-ol (PubChem CID 146162326) has the molecular formula C14H26O2Si and a molecular weight of 254.45 g/mol. Its IUPAC name is (E,4S)-4-[tert-butyl(dimethyl)silyl]oxyoct-5-en-7-yn-1-ol.
| Compound Name | (E,4S)-4-[tert-butyl(dimethyl)silyl]oxyoct-5-en-7-yn-1-ol |
|---|---|
| PubChem CID | 146162326 |
| Molecular Formula | C14H26O2Si |
| Molecular Weight | 254.45 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | (E,4S)-4-[tert-butyl(dimethyl)silyl]oxyoct-5-en-7-yn-1-ol |
| SMILES | C#C/C=C/[C@H](CCCO)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H26O2Si/c1-7-8-10-13(11-9-12-15)16-17(5,6)14(2,3)4/h1,8,10,13,15H,9,11-12H2,2-6H3/b10-8+/t13-/m1/s1 |
| InChIKey | YGCFFZXJFDJSBE-AORWBKJGSA-N |
| XLogP | 3.34 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.45 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|