C22H25NO — CID 146163406
trans-(1S,2S)-2-[benzyl(3-phenylprop-2-ynyl)amino]cyclohexan-1-ol (PubChem CID 146163406) has the molecular formula C22H25NO and a molecular weight of 319.45 g/mol. Its IUPAC name is trans-(1S,2S)-2-[benzyl(3-phenylprop-2-ynyl)amino]cyclohexan-1-ol.
| Compound Name | trans-(1S,2S)-2-[benzyl(3-phenylprop-2-ynyl)amino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 146163406 |
| Molecular Formula | C22H25NO |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | trans-(1S,2S)-2-[benzyl(3-phenylprop-2-ynyl)amino]cyclohexan-1-ol |
| SMILES | O[C@H]1CCCC[C@@H]1N(CC#Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C22H25NO/c24-22-16-8-7-15-21(22)23(18-20-12-5-2-6-13-20)17-9-14-19-10-3-1-4-11-19/h1-6,10-13,21-22,24H,7-8,15-18H2/t21-,22-/m0/s1 |
| InChIKey | BZDGFWVTIBPGAG-VXKWHMMOSA-N |
| XLogP | 3.84 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|