C29H33NO2 — CID 146163532
N-[(3R)-1-cyclohexyl-3-hydroxy-3,4-diphenylbutyl]benzamide (PubChem CID 146163532) has the molecular formula C29H33NO2 and a molecular weight of 427.59 g/mol. Its IUPAC name is N-[(3R)-1-cyclohexyl-3-hydroxy-3,4-diphenylbutyl]benzamide.
| Compound Name | N-[(3R)-1-cyclohexyl-3-hydroxy-3,4-diphenylbutyl]benzamide |
|---|---|
| PubChem CID | 146163532 |
| Molecular Formula | C29H33NO2 |
| Molecular Weight | 427.59 g/mol |
| Exact Mass | 427.25 |
| IUPAC Name | N-[(3R)-1-cyclohexyl-3-hydroxy-3,4-diphenylbutyl]benzamide |
| SMILES | O=C(NC(C[C@](O)(Cc1ccccc1)c1ccccc1)C1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C29H33NO2/c31-28(25-17-9-3-10-18-25)30-27(24-15-7-2-8-16-24)22-29(32,26-19-11-4-12-20-26)21-23-13-5-1-6-14-23/h1,3-6,9-14,17-20,24,27,32H,2,7-8,15-16,21-22H2,(H,30,31)/t27?,29-/m1/s1 |
| InChIKey | XLMHYZYVXRLAPR-ZBAATNBSSA-N |
| XLogP | 5.89 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.59 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |