C10H19O4Zn- — CID 146163625
ethane;methyl (Z,2R)-2-ethyl-4-hydroxy-4-methoxybut-3-enoate;zinc (PubChem CID 146163625) has the molecular formula C10H19O4Zn- and a molecular weight of 268.65 g/mol. Its IUPAC name is ethane;methyl (Z,2R)-2-ethyl-4-hydroxy-4-methoxybut-3-enoate;zinc.
| Compound Name | ethane;methyl (Z,2R)-2-ethyl-4-hydroxy-4-methoxybut-3-enoate;zinc |
|---|---|
| PubChem CID | 146163625 |
| Molecular Formula | C10H19O4Zn- |
| Molecular Weight | 268.65 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | ethane;methyl (Z,2R)-2-ethyl-4-hydroxy-4-methoxybut-3-enoate;zinc |
| SMILES | CC[C@H](/C=C(/O)OC)C(=O)OC.[CH2-]C.[Zn] |
| InChI | InChI=1S/C8H14O4.C2H5.Zn/c1-4-6(8(10)12-3)5-7(9)11-2;1-2;/h5-6,9H,4H2,1-3H3;1H2,2H3;/q;-1;/b7-5-;;/t6-;;/m1../s1 |
| InChIKey | DOFZHAOQXAWVOW-JRKMCZESSA-N |
| XLogP | 2.07 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.65 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|