C20H33+ — CID 146163985
CID 146163985 (PubChem CID 146163985) has the molecular formula C20H33+ and a molecular weight of 273.48 g/mol.
| Compound Name | CID 146163985 |
|---|---|
| PubChem CID | 146163985 |
| Molecular Formula | C20H33+ |
| Molecular Weight | 273.48 g/mol |
| Exact Mass | 273.26 |
| IUPAC Name | — |
| SMILES | C/C1=C\CC2CC[C@@H](C)[C@](C)(CC/C(C)=C/CC1)[C+]2C |
| InChI | InChI=1S/C20H33/c1-15-7-6-8-16(2)13-14-20(5)17(3)10-12-19(11-9-15)18(20)4/h8-9,17,19H,6-7,10-14H2,1-5H3/q+1/b15-9+,16-8+/t17-,19?,20+/m1/s1 |
| InChIKey | OWMZMCAGJKWRDG-GJXMDAQGSA-N |
| XLogP | 6.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.48 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|