C32H32F6Si2 — CID 146164081
[2-[dimethyl(phenyl)silyl]-1,2-bis[4-(trifluoromethyl)phenyl]ethyl]-dimethyl-phenylsilane (PubChem CID 146164081) has the molecular formula C32H32F6Si2 and a molecular weight of 586.77 g/mol. Its IUPAC name is [2-[dimethyl(phenyl)silyl]-1,2-bis[4-(trifluoromethyl)phenyl]ethyl]-dimethyl-phenylsilane.
| Compound Name | [2-[dimethyl(phenyl)silyl]-1,2-bis[4-(trifluoromethyl)phenyl]ethyl]-dimethyl-phenylsilane |
|---|---|
| PubChem CID | 146164081 |
| Molecular Formula | C32H32F6Si2 |
| Molecular Weight | 586.77 g/mol |
| Exact Mass | 586.19 |
| IUPAC Name | [2-[dimethyl(phenyl)silyl]-1,2-bis[4-(trifluoromethyl)phenyl]ethyl]-dimethyl-phenylsilane |
| SMILES | C[Si](C)(c1ccccc1)C(c1ccc(C(F)(F)F)cc1)C(c1ccc(C(F)(F)F)cc1)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C32H32F6Si2/c1-39(2,27-11-7-5-8-12-27)29(23-15-19-25(20-16-23)31(33,34)35)30(40(3,4)28-13-9-6-10-14-28)24-17-21-26(22-18-24)32(36,37)38/h5-22,29-30H,1-4H3 |
| InChIKey | IHJVYORRYQLQRX-UHFFFAOYSA-N |
| XLogP | 8.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.77 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|