C23H28BNO2 — CID 146164362
4-[1-phenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]-1H-indole (PubChem CID 146164362) has the molecular formula C23H28BNO2 and a molecular weight of 361.29 g/mol. Its IUPAC name is 4-[1-phenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]-1H-indole.
| Compound Name | 4-[1-phenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]-1H-indole |
|---|---|
| PubChem CID | 146164362 |
| Molecular Formula | C23H28BNO2 |
| Molecular Weight | 361.29 g/mol |
| Exact Mass | 361.22 |
| IUPAC Name | 4-[1-phenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]-1H-indole |
| SMILES | CC1(C)OB(CCC(c2ccccc2)c2cccc3[nH]ccc23)OC1(C)C |
| InChI | InChI=1S/C23H28BNO2/c1-22(2)23(3,4)27-24(26-22)15-13-18(17-9-6-5-7-10-17)19-11-8-12-21-20(19)14-16-25-21/h5-12,14,16,18,25H,13,15H2,1-4H3 |
| InChIKey | LLAIUMPVMUXDCF-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 34.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.29 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|