C52H64N4O6S — CID 146164734
bis[(S)-(6-butoxyquinolin-4-yl)-[(2S,4S,5R)-5-ethyl-1-azabicyclo[2.2.2]octan-2-yl]methyl] thiophene-2,5-dicarboxylate (PubChem CID 146164734) has the molecular formula C52H64N4O6S and a molecular weight of 873.17 g/mol. Its IUPAC name is bis[(S)-(6-butoxyquinolin-4-yl)-[(2S,4S,5R)-5-ethyl-1-azabicyclo[2.2.2]octan-2-yl]methyl] thiophene-2,5-dicarboxylate.
| Compound Name | bis[(S)-(6-butoxyquinolin-4-yl)-[(2S,4S,5R)-5-ethyl-1-azabicyclo[2.2.2]octan-2-yl]methyl] thiophene-2,5-dicarboxylate |
|---|---|
| PubChem CID | 146164734 |
| Molecular Formula | C52H64N4O6S |
| Molecular Weight | 873.17 g/mol |
| Exact Mass | 872.45 |
| IUPAC Name | bis[(S)-(6-butoxyquinolin-4-yl)-[(2S,4S,5R)-5-ethyl-1-azabicyclo[2.2.2]octan-2-yl]methyl] thiophene-2,5-dicarboxylate |
| SMILES | CCCCOc1ccc2nccc([C@H](OC(=O)c3ccc(C(=O)O[C@@H](c4ccnc5ccc(OCCCC)cc45)[C@@H]4C[C@@H]5CCN4C[C@@H]5CC)s3)[C@@H]3C[C@@H]4CCN3C[C@@H]4CC)c2c1 |
| InChI | InChI=1S/C52H64N4O6S/c1-5-9-25-59-37-11-13-43-41(29-37)39(17-21-53-43)49(45-27-35-19-23-55(45)31-33(35)7-3)61-51(57)47-15-16-48(63-47)52(58)62-50(46-28-36-20-24-56(46)32-34(36)8-4)40-18-22-54-44-14-12-38(30-42(40)44)60-26-10-6-2/h11-18,21-22,29-30,33-36,45-46,49-50H,5-10,19-20,23-28,31-32H2,1-4H3/t33-,34-,35-,36-,45-,46-,49-,50-/m0/s1 |
| InChIKey | AFZAERNOOGYDJA-ZRADMBFVSA-N |
| XLogP | 11.24 |
| TPSA | 103.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 63 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 873.17 |
| LogP ≤ 5 | 11.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|