C22H19NO4S — CID 146165732
methyl 2-(4-nitrophenyl)sulfanyl-2,3-diphenylpropanoate (PubChem CID 146165732) has the molecular formula C22H19NO4S and a molecular weight of 393.46 g/mol. Its IUPAC name is methyl 2-(4-nitrophenyl)sulfanyl-2,3-diphenylpropanoate.
| Compound Name | methyl 2-(4-nitrophenyl)sulfanyl-2,3-diphenylpropanoate |
|---|---|
| PubChem CID | 146165732 |
| Molecular Formula | C22H19NO4S |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | methyl 2-(4-nitrophenyl)sulfanyl-2,3-diphenylpropanoate |
| SMILES | COC(=O)C(Cc1ccccc1)(Sc1ccc([N+](=O)[O-])cc1)c1ccccc1 |
| InChI | InChI=1S/C22H19NO4S/c1-27-21(24)22(18-10-6-3-7-11-18,16-17-8-4-2-5-9-17)28-20-14-12-19(13-15-20)23(25)26/h2-15H,16H2,1H3 |
| InChIKey | DDOAQEFEAAWOBH-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|