C17H16F5NO4S — CID 53343234
ethyl 2-[2-nitro-5-(pentafluoro-λ6-sulfanyl)phenyl]-3-phenylpropanoate (PubChem CID 53343234) has the molecular formula C17H16F5NO4S and a molecular weight of 425.38 g/mol. Its IUPAC name is ethyl 2-[2-nitro-5-(pentafluoro-λ6-sulfanyl)phenyl]-3-phenylpropanoate.
| Compound Name | ethyl 2-[2-nitro-5-(pentafluoro-λ6-sulfanyl)phenyl]-3-phenylpropanoate |
|---|---|
| PubChem CID | 53343234 |
| Molecular Formula | C17H16F5NO4S |
| Molecular Weight | 425.38 g/mol |
| Exact Mass | 425.07 |
| IUPAC Name | ethyl 2-[2-nitro-5-(pentafluoro-λ6-sulfanyl)phenyl]-3-phenylpropanoate |
| SMILES | CCOC(=O)C(Cc1ccccc1)c1cc(S(F)(F)(F)(F)F)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H16F5NO4S/c1-2-27-17(24)15(10-12-6-4-3-5-7-12)14-11-13(28(18,19,20,21)22)8-9-16(14)23(25)26/h3-9,11,15H,2,10H2,1H3 |
| InChIKey | STVJOZQEGQCJRY-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.38 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|