C18H22N2O3 — CID 146166726
3-[(2S,3S)-3-phenyl-2-pyrrolidin-1-ylpent-4-enoyl]-1,3-oxazolidin-2-one (PubChem CID 146166726) has the molecular formula C18H22N2O3 and a molecular weight of 314.39 g/mol. Its IUPAC name is 3-[(2S,3S)-3-phenyl-2-pyrrolidin-1-ylpent-4-enoyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[(2S,3S)-3-phenyl-2-pyrrolidin-1-ylpent-4-enoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 146166726 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 3-[(2S,3S)-3-phenyl-2-pyrrolidin-1-ylpent-4-enoyl]-1,3-oxazolidin-2-one |
| SMILES | C=C[C@@H](c1ccccc1)[C@@H](C(=O)N1CCOC1=O)N1CCCC1 |
| InChI | InChI=1S/C18H22N2O3/c1-2-15(14-8-4-3-5-9-14)16(19-10-6-7-11-19)17(21)20-12-13-23-18(20)22/h2-5,8-9,15-16H,1,6-7,10-13H2/t15-,16-/m0/s1 |
| InChIKey | TVLWKGHEQOUAQS-HOTGVXAUSA-N |
| XLogP | 2.40 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|