C20H33BO2 — CID 146168144
4,4,5,5-tetramethyl-2-[(Z)-4-[(1R,5S)-2-methylidene-5-prop-1-en-2-ylcyclohexyl]but-2-en-2-yl]-1,3,2-dioxaborolane (PubChem CID 146168144) has the molecular formula C20H33BO2 and a molecular weight of 316.29 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[(Z)-4-[(1R,5S)-2-methylidene-5-prop-1-en-2-ylcyclohexyl]but-2-en-2-yl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[(Z)-4-[(1R,5S)-2-methylidene-5-prop-1-en-2-ylcyclohexyl]but-2-en-2-yl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 146168144 |
| Molecular Formula | C20H33BO2 |
| Molecular Weight | 316.29 g/mol |
| Exact Mass | 316.26 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[(Z)-4-[(1R,5S)-2-methylidene-5-prop-1-en-2-ylcyclohexyl]but-2-en-2-yl]-1,3,2-dioxaborolane |
| SMILES | C=C(C)[C@H]1CCC(=C)[C@H](C/C=C(\C)B2OC(C)(C)C(C)(C)O2)C1 |
| InChI | InChI=1S/C20H33BO2/c1-14(2)17-11-9-15(3)18(13-17)12-10-16(4)21-22-19(5,6)20(7,8)23-21/h10,17-18H,1,3,9,11-13H2,2,4-8H3/b16-10+/t17-,18+/m0/s1 |
| InChIKey | BLVBUTSJHCDSNT-HMBXQEKBSA-N |
| XLogP | 5.50 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.29 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|