C23H39IOSi — CID 146168334
[(1R)-1-[(1R,3aS,3bR,6aR)-1,4,4,6a-tetramethyl-2,3,3a,3b,5,6-hexahydrocyclopenta[a]pentalen-1-yl]-4-iodopent-4-enoxy]-trimethylsilane (PubChem CID 146168334) has the molecular formula C23H39IOSi and a molecular weight of 486.55 g/mol. Its IUPAC name is [(1R)-1-[(1R,3aS,3bR,6aR)-1,4,4,6a-tetramethyl-2,3,3a,3b,5,6-hexahydrocyclopenta[a]pentalen-1-yl]-4-iodopent-4-enoxy]-trimethylsilane.
| Compound Name | [(1R)-1-[(1R,3aS,3bR,6aR)-1,4,4,6a-tetramethyl-2,3,3a,3b,5,6-hexahydrocyclopenta[a]pentalen-1-yl]-4-iodopent-4-enoxy]-trimethylsilane |
|---|---|
| PubChem CID | 146168334 |
| Molecular Formula | C23H39IOSi |
| Molecular Weight | 486.55 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | [(1R)-1-[(1R,3aS,3bR,6aR)-1,4,4,6a-tetramethyl-2,3,3a,3b,5,6-hexahydrocyclopenta[a]pentalen-1-yl]-4-iodopent-4-enoxy]-trimethylsilane |
| SMILES | C=C(I)CC[C@@H](O[Si](C)(C)C)[C@]1(C)CC[C@@H]2C1=C[C@@]1(C)CCC(C)(C)[C@@H]21 |
| InChI | InChI=1S/C23H39IOSi/c1-16(24)9-10-19(25-26(6,7)8)23(5)12-11-17-18(23)15-22(4)14-13-21(2,3)20(17)22/h15,17,19-20H,1,9-14H2,2-8H3/t17-,19-,20-,22-,23-/m1/s1 |
| InChIKey | WRYJTVXOFQQYNU-HURHVGRMSA-N |
| XLogP | 7.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.55 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|