C22H37IOSi — CID 155934827
[(1R)-1-[(1R,3aS,3bR,6aR)-1,4,4,6a-tetramethyl-2,3,3a,3b,5,6-hexahydrocyclopenta[a]pentalen-1-yl]-3-iodobut-3-enoxy]-trimethylsilane (PubChem CID 155934827) has the molecular formula C22H37IOSi and a molecular weight of 472.53 g/mol. Its IUPAC name is [(1R)-1-[(1R,3aS,3bR,6aR)-1,4,4,6a-tetramethyl-2,3,3a,3b,5,6-hexahydrocyclopenta[a]pentalen-1-yl]-3-iodobut-3-enoxy]-trimethylsilane.
| Compound Name | [(1R)-1-[(1R,3aS,3bR,6aR)-1,4,4,6a-tetramethyl-2,3,3a,3b,5,6-hexahydrocyclopenta[a]pentalen-1-yl]-3-iodobut-3-enoxy]-trimethylsilane |
|---|---|
| PubChem CID | 155934827 |
| Molecular Formula | C22H37IOSi |
| Molecular Weight | 472.53 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | [(1R)-1-[(1R,3aS,3bR,6aR)-1,4,4,6a-tetramethyl-2,3,3a,3b,5,6-hexahydrocyclopenta[a]pentalen-1-yl]-3-iodobut-3-enoxy]-trimethylsilane |
| SMILES | C=C(I)C[C@@H](O[Si](C)(C)C)[C@]1(C)CC[C@@H]2C1=C[C@@]1(C)CCC(C)(C)[C@@H]21 |
| InChI | InChI=1S/C22H37IOSi/c1-15(23)13-18(24-25(6,7)8)22(5)10-9-16-17(22)14-21(4)12-11-20(2,3)19(16)21/h14,16,18-19H,1,9-13H2,2-8H3/t16-,18-,19-,21-,22-/m1/s1 |
| InChIKey | KWXRNFCEKAXERZ-RTTUQUNYSA-N |
| XLogP | 7.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.53 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|