C11H16O3 — CID 146168633
ethyl (2E)-4,4-dimethyl-5-oxohepta-2,6-dienoate (PubChem CID 146168633) has the molecular formula C11H16O3 and a molecular weight of 196.25 g/mol. Its IUPAC name is ethyl (2E)-4,4-dimethyl-5-oxohepta-2,6-dienoate.
| Compound Name | ethyl (2E)-4,4-dimethyl-5-oxohepta-2,6-dienoate |
|---|---|
| PubChem CID | 146168633 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | ethyl (2E)-4,4-dimethyl-5-oxohepta-2,6-dienoate |
| SMILES | C=CC(=O)C(C)(C)/C=C/C(=O)OCC |
| InChI | InChI=1S/C11H16O3/c1-5-9(12)11(3,4)8-7-10(13)14-6-2/h5,7-8H,1,6H2,2-4H3/b8-7+ |
| InChIKey | AQFAMONILDSINR-BQYQJAHWSA-N |
| XLogP | 1.89 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|