C43H48N2O3SSi — CID 146168867
benzyl 6-(4-methoxyphenyl)-11-thiophen-2-yl-3-tri(propan-2-yl)silyl-9,10-dihydro-7H-indolo[4,5-g]isoquinoline-8-carboxylate (PubChem CID 146168867) has the molecular formula C43H48N2O3SSi and a molecular weight of 701.02 g/mol. Its IUPAC name is benzyl 6-(4-methoxyphenyl)-11-thiophen-2-yl-3-tri(propan-2-yl)silyl-9,10-dihydro-7H-indolo[4,5-g]isoquinoline-8-carboxylate.
| Compound Name | benzyl 6-(4-methoxyphenyl)-11-thiophen-2-yl-3-tri(propan-2-yl)silyl-9,10-dihydro-7H-indolo[4,5-g]isoquinoline-8-carboxylate |
|---|---|
| PubChem CID | 146168867 |
| Molecular Formula | C43H48N2O3SSi |
| Molecular Weight | 701.02 g/mol |
| Exact Mass | 700.32 |
| IUPAC Name | benzyl 6-(4-methoxyphenyl)-11-thiophen-2-yl-3-tri(propan-2-yl)silyl-9,10-dihydro-7H-indolo[4,5-g]isoquinoline-8-carboxylate |
| SMILES | COc1ccc(-c2c3c(c(-c4cccs4)c4c2ccc2c4ccn2[Si](C(C)C)(C(C)C)C(C)C)CCN(C(=O)OCc2ccccc2)C3)cc1 |
| InChI | InChI=1S/C43H48N2O3SSi/c1-28(2)50(29(3)4,30(5)6)45-24-22-35-38(45)20-19-36-40(32-15-17-33(47-7)18-16-32)37-26-44(43(46)48-27-31-12-9-8-10-13-31)23-21-34(37)42(41(35)36)39-14-11-25-49-39/h8-20,22,24-25,28-30H,21,23,26-27H2,1-7H3 |
| InChIKey | QQDKHBIOHWUPBP-UHFFFAOYSA-N |
| XLogP | 11.92 |
| TPSA | 43.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.02 |
| LogP ≤ 5 | 11.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|