C35H38N2OSSi — CID 158602266
[6-(4-methoxyphenyl)-11-thiophen-2-ylindolo[4,5-g]isoquinolin-3-yl]-tri(propan-2-yl)silane (PubChem CID 158602266) has the molecular formula C35H38N2OSSi and a molecular weight of 562.86 g/mol. Its IUPAC name is [6-(4-methoxyphenyl)-11-thiophen-2-ylindolo[4,5-g]isoquinolin-3-yl]-tri(propan-2-yl)silane.
| Compound Name | [6-(4-methoxyphenyl)-11-thiophen-2-ylindolo[4,5-g]isoquinolin-3-yl]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 158602266 |
| Molecular Formula | C35H38N2OSSi |
| Molecular Weight | 562.86 g/mol |
| Exact Mass | 562.25 |
| IUPAC Name | [6-(4-methoxyphenyl)-11-thiophen-2-ylindolo[4,5-g]isoquinolin-3-yl]-tri(propan-2-yl)silane |
| SMILES | COc1ccc(-c2c3cnccc3c(-c3cccs3)c3c2ccc2c3ccn2[Si](C(C)C)(C(C)C)C(C)C)cc1 |
| InChI | InChI=1S/C35H38N2OSSi/c1-22(2)40(23(3)4,24(5)6)37-19-17-28-31(37)15-14-29-33(25-10-12-26(38-7)13-11-25)30-21-36-18-16-27(30)35(34(28)29)32-9-8-20-39-32/h8-24H,1-7H3 |
| InChIKey | LWBSVMWPAWVZFK-UHFFFAOYSA-N |
| XLogP | 10.77 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.86 |
| LogP ≤ 5 | 10.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|