C26H25N2OS+ — CID 171037376
2-[[6-(4-methoxyphenyl)-1-methylquinolin-1-ium-4-yl]methyl]-3-methyl-2H-1,3-benzothiazole (PubChem CID 171037376) has the molecular formula C26H25N2OS+ and a molecular weight of 413.57 g/mol. Its IUPAC name is 2-[[6-(4-methoxyphenyl)-1-methylquinolin-1-ium-4-yl]methyl]-3-methyl-2H-1,3-benzothiazole.
| Compound Name | 2-[[6-(4-methoxyphenyl)-1-methylquinolin-1-ium-4-yl]methyl]-3-methyl-2H-1,3-benzothiazole |
|---|---|
| PubChem CID | 171037376 |
| Molecular Formula | C26H25N2OS+ |
| Molecular Weight | 413.57 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | 2-[[6-(4-methoxyphenyl)-1-methylquinolin-1-ium-4-yl]methyl]-3-methyl-2H-1,3-benzothiazole |
| SMILES | COc1ccc(-c2ccc3c(c2)c(CC2Sc4ccccc4N2C)cc[n+]3C)cc1 |
| InChI | InChI=1S/C26H25N2OS/c1-27-15-14-20(17-26-28(2)24-6-4-5-7-25(24)30-26)22-16-19(10-13-23(22)27)18-8-11-21(29-3)12-9-18/h4-16,26H,17H2,1-3H3/q+1 |
| InChIKey | AZKWRHPJSWVBEC-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 16.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.57 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|