C28H36INOS — CID 72697302
1-(5-cyclohexylpentyl)-3-[(2-methoxyphenyl)methylsulfanyl]quinolin-1-ium iodide (PubChem CID 72697302) has the molecular formula C28H36INOS and a molecular weight of 561.57 g/mol. Its IUPAC name is 1-(5-cyclohexylpentyl)-3-[(2-methoxyphenyl)methylsulfanyl]quinolin-1-ium iodide.
| Compound Name | 1-(5-cyclohexylpentyl)-3-[(2-methoxyphenyl)methylsulfanyl]quinolin-1-ium iodide |
|---|---|
| PubChem CID | 72697302 |
| Molecular Formula | C28H36INOS |
| Molecular Weight | 561.57 g/mol |
| Exact Mass | 561.16 |
| IUPAC Name | 1-(5-cyclohexylpentyl)-3-[(2-methoxyphenyl)methylsulfanyl]quinolin-1-ium iodide |
| SMILES | COc1ccccc1CSc1cc2ccccc2[n+](CCCCCC2CCCCC2)c1.[I-] |
| InChI | InChI=1S/C28H36NOS.HI/c1-30-28-18-10-8-16-25(28)22-31-26-20-24-15-7-9-17-27(24)29(21-26)19-11-3-6-14-23-12-4-2-5-13-23;/h7-10,15-18,20-21,23H,2-6,11-14,19,22H2,1H3;1H/q+1;/p-1 |
| InChIKey | UHZFFTJBHZEVIA-UHFFFAOYSA-M |
| XLogP | 4.57 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.57 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|